CAS 3815-30-3
:(3E)-4-(4-Methoxyphenyl)-3-buten-2-one
Description:
(3E)-4-(4-Methoxyphenyl)-3-buten-2-one, commonly referred to as a type of chalcone, is an organic compound characterized by its conjugated double bond system and a ketone functional group. This compound features a methoxy group (-OCH3) attached to a phenyl ring, which contributes to its aromatic properties and potential reactivity. The presence of the butenone structure indicates that it has a double bond between the second and third carbon atoms of the butenone chain, which is crucial for its chemical behavior, including its ability to participate in various reactions such as Michael addition and aldol condensation. Chalcones are known for their biological activities, including anti-inflammatory, antioxidant, and antimicrobial properties, making them of interest in medicinal chemistry. The compound is typically a yellow to orange solid at room temperature and is soluble in organic solvents. Its unique structure and properties make it a valuable compound for research in organic synthesis and pharmacology.
Formula:C11H12O2
InChI:InChI=1S/C11H12O2/c1-9(12)3-4-10-5-7-11(13-2)8-6-10/h3-8H,1-2H3/b4-3+
InChI key:InChIKey=WRRZKDVBPZBNJN-ONEGZZNKSA-N
SMILES:C(=C/C(C)=O)\C1=CC=C(OC)C=C1
Synonyms:- (2E)-4-(4-Methoxyphenyl)-3-buten-2-one
- (3E)-4-(4-Methoxyphenyl)-3-buten-2-one
- (3E)-4-(4-Methoxyphenyl)but-3-en-2-one
- (E)-4-(4-Methoxyphenyl)-3-buten-2-one
- (E)-4-(4-Methoxyphenyl)but-3-en-2-one
- (E)-4-(p-Methoxyphenyl)-3-buten-2-one
- 3-Buten-2-one, 4-(p-methoxyphenyl)-, trans-
- 3-Buten-2-one, 4-(p-methoxyphenyl)-, trans- (8CI)
- 3-Buten-2-one,4-(4-methoxyphenyl)-, (E)-
- 4-(4-Methoxyphenyl)-(3E)-buten-2-one
- trans-(4-Methoxybenzylidene)acetone
- trans-4-(4-Methoxyphenyl)but-3-en-2-one
- trans-4-[4-Methoxyphenyl)-3-buten-2-one
- 3-Buten-2-one, 4-(4-methoxyphenyl)-, (3E)-
- Mepyramine Impurity 4
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
