CymitQuimica logo

CAS 38160-04-2

:

(3R)-1-(4-ethoxyphenyl)-5-oxopyrrolidine-3-carboxylate

Description:
The chemical substance known as (3R)-1-(4-ethoxyphenyl)-5-oxopyrrolidine-3-carboxylate, with the CAS number 38160-04-2, is a pyrrolidine derivative characterized by its unique structural features. It contains a pyrrolidine ring, which is a five-membered cyclic amine, and is substituted with a carboxylate group and an ethoxyphenyl moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity due to its structural resemblance to various pharmacologically active compounds. The presence of the ethoxy group may influence its lipophilicity and biological interactions. Additionally, the stereochemistry at the 3-position (designated as (3R)) suggests that the compound may exhibit specific chiral properties, which can affect its reactivity and interactions in biological systems. Overall, this compound may be of interest in medicinal chemistry and drug development, particularly in the context of designing new therapeutic agents.
Formula:C13H14NO4
InChI:InChI=1/C13H15NO4/c1-2-18-11-5-3-10(4-6-11)14-8-9(13(16)17)7-12(14)15/h3-6,9H,2,7-8H2,1H3,(H,16,17)/p-1/t9-/m1/s1
SMILES:CCOc1ccc(cc1)N1C[C@@H](CC1=O)C(=O)[O-]
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.