CymitQuimica logo

CAS 38160-63-3

:

2-amino-4-hydroxybenzoic acid

Description:
2-Amino-4-hydroxybenzoic acid, also known as para-aminosalicylic acid (PAS), is an aromatic compound characterized by the presence of both an amino group (-NH2) and a hydroxyl group (-OH) attached to a benzene ring that also contains a carboxylic acid group (-COOH). This compound is a white to off-white crystalline powder that is soluble in water and exhibits a slightly acidic nature due to the carboxylic acid functionality. It is primarily known for its role as an antitubercular agent, particularly in the treatment of tuberculosis, where it acts by inhibiting the synthesis of folic acid in bacteria. Additionally, 2-amino-4-hydroxybenzoic acid has been studied for its potential antioxidant properties and its role in various biochemical pathways. Its molecular structure allows for hydrogen bonding, contributing to its solubility and reactivity. As with many amino acids and their derivatives, it can participate in various chemical reactions, making it a compound of interest in both medicinal chemistry and biochemistry.
Formula:C7H7NO3
InChI:InChI=1/C7H7NO3/c8-6-3-4(9)1-2-5(6)7(10)11/h1-3,9H,8H2,(H,10,11)
InChI key:DPELYVFAULJYNX-UHFFFAOYSA-N
SMILES:c1cc(c(cc1O)N)C(=O)O
Synonyms:
  • Benzoic Acid, 2-Amino-4-Hydroxy-
  • 2-Amino-4-hydroxybenzoic acid
Found 5 products.