CAS 381683-92-7
:4-{2-[5-chloro-2-(2-{[(3,4-dichlorobenzyl)sulfonyl]amino}ethyl)-1-(diphenylmethyl)-1H-indol-3-yl]ethoxy}benzoic acid
Description:
The chemical substance known as 4-{2-[5-chloro-2-(2-{[(3,4-dichlorobenzyl)sulfonyl]amino}ethyl)-1-(diphenylmethyl)-1H-indol-3-yl]ethoxy}benzoic acid, with the CAS number 381683-92-7, is a complex organic compound characterized by its intricate molecular structure. It features multiple functional groups, including a benzoic acid moiety, an indole ring, and a sulfonamide linkage, which contribute to its potential biological activity. The presence of chlorine atoms suggests that it may exhibit specific reactivity or biological interactions, potentially influencing its pharmacological properties. This compound is likely to be of interest in medicinal chemistry, particularly in the development of therapeutic agents, due to its structural complexity and the presence of various substituents that can affect its solubility, stability, and interaction with biological targets. As with many synthetic organic compounds, its properties, such as solubility, melting point, and biological activity, would need to be characterized through experimental studies to fully understand its potential applications.
Formula:C39H33Cl3N2O5S
InChI:InChI=1/C39H33Cl3N2O5S/c40-30-14-18-36-33(24-30)32(20-22-49-31-15-12-29(13-16-31)39(45)46)37(19-21-43-50(47,48)25-26-11-17-34(41)35(42)23-26)44(36)38(27-7-3-1-4-8-27)28-9-5-2-6-10-28/h1-18,23-24,38,43H,19-22,25H2,(H,45,46)
SMILES:c1ccc(cc1)C(c1ccccc1)n1c2ccc(cc2c(CCOc2ccc(cc2)C(=O)O)c1CCNS(=O)(=O)Cc1ccc(c(c1)Cl)Cl)Cl
Synonyms:- benzoic acid, 4-[2-[5-chloro-2-[2-[[[(3,4-dichlorophenyl)methyl]sulfonyl]amino]ethyl]-1-(diphenylmethyl)-1H-indol-3-yl]ethoxy]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Ecopladib
CAS:Ecopladib (also known as EC-P) is a novel synthetic compound that is a potent metalloprotease inhibitor. This drug is most effective in inhibiting the activity of serine proteases, such as plasmin and cathepsin B. Ecopladib has shown efficacy in animal models of acute renal injury, with its antiinflammatory activity being mediated by its ability to block the production of inflammatory cytokines. This drug also protects against acute kidney injury through its inhibition of the activity of c1-6 alkyl groups.Formula:C39H33Cl3N2O5SPurity:Min. 95%Molecular weight:748.1 g/molEcopladib
CAS:Ecopladib inhibits cPLA2α with IC50 of 0.15 μM (micelles) & 0.11 μM (rat blood).Formula:C39H33Cl3N2O5SPurity:95.15%Color and Shape:SolidMolecular weight:748.11Ref: TM-T11149
1mL*10mM (DMSO)To inquire1mg315.00€5mg630.00€10mg850.00€25mg1,234.00€50mg1,693.00€100mg2,305.00€


