CAS 381716-33-2: [(2R,3S,4S,5R)-3,4,5-triacetoxy-6-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]tetrahydropyran-2-yl]methyl acetate
Description:The chemical substance with the name "[(2R,3S,4S,5R)-3,4,5-triacetoxy-6-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]tetrahydropyran-2-yl]methyl acetate" and CAS number "381716-33-2" is a complex organic compound characterized by its multi-functional groups and stereochemistry. It features a tetrahydropyran ring, which is a six-membered cyclic ether, and is substituted with multiple acetoxy groups, contributing to its reactivity and potential applications in organic synthesis. The presence of an azido group indicates potential for further chemical transformations, particularly in click chemistry, which is valuable in bioconjugation and material science. The stereochemical configuration (2R,3S,4S,5R) suggests specific spatial arrangements that can influence the compound's biological activity and interaction with other molecules. This compound may be of interest in medicinal chemistry and drug development due to its structural complexity and functional diversity. Its solubility, stability, and reactivity would depend on the specific conditions and solvents used in experiments or applications.
Formula:C20H31N3O12
InChI:InChI=1/C20H31N3O12/c1-12(24)31-11-16-17(32-13(2)25)18(33-14(3)26)19(34-15(4)27)20(35-16)30-10-9-29-8-7-28-6-5-22-23-21/h16-20H,5-11H2,1-4H3/t16-,17+,18+,19-,20?/m1/s1
- Synonyms:
- D-Galactose 1-[2-(2-Azidoethoxy)ethoxyethyl]-2,3,4,6-tetra-O-acetate

2-[2-(2-Azidoethoxy)ethoxy]ethyl 2,3,4,6-Tetra-O-acetyl-D-galactopyranoside
Ref: 3B-G0257
1g | 207.00 € | ||
5g | 683.00 € |

D-GALACTOSE 1-[2-(2-AZIDOETHOXY)ETHOXYETHYL]-2,3,4,6-TETRA-O-ACETATE
Ref: IN-DA003PA0
1g | To inquire | ||
100mg | 142.00 € |

1-[2-(2-Azidoethoxy)ethoxyethyl]-2,3,4,6-tetra-O-acetyl-D-galactopyranoside
Ref: 3D-MA07052
1g | 376.00 € | ||
2g | 526.00 € | ||
5g | 962.00 € | ||
10g | 1,707.00 € | ||
500mg | 243.00 € |