CymitQuimica logo

CAS 381721-55-7

:

1-[2-(1H-imidazol-1-yl)ethyl]piperazine

Description:
1-[2-(1H-imidazol-1-yl)ethyl]piperazine is a chemical compound characterized by its unique structure, which includes a piperazine ring and an imidazole moiety. This compound features a piperazine core, a six-membered saturated heterocyclic amine, which is substituted at one nitrogen atom with a 2-(1H-imidazol-1-yl)ethyl group. The imidazole ring contributes to the compound's potential biological activity, as imidazole derivatives are often found in various pharmacologically active substances. The presence of both nitrogen-containing heterocycles may enhance its solubility and interaction with biological targets. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as it may exhibit properties such as antimicrobial, antifungal, or anticancer activities. Its molecular structure allows for various modifications, which can lead to the exploration of different therapeutic effects. As with many chemical substances, safety and handling precautions should be observed, and its properties should be evaluated in the context of specific applications.
Formula:C9H16N4
InChI:InChI=1/C9H16N4/c1-4-12(5-2-10-1)7-8-13-6-3-11-9-13/h3,6,9-10H,1-2,4-5,7-8H2
SMILES:C1CN(CCN1)CCn1ccnc1
Synonyms:
  • Piperazine, 1-[2-(1H-imidazol-1-yl)ethyl]-
  • 1-[2-(1H-Imidazol-1-yl)ethyl]piperazine
Found 2 products.