CAS 381721-56-8

1-[2-(1H-Pyrazol-1-yl)ethyl]piperazine

Description:

1-[2-(1H-Pyrazol-1-yl)ethyl]piperazine is a chemical compound characterized by its unique structure, which includes a piperazine ring and a pyrazole moiety. This compound typically exhibits properties such as being a colorless to pale yellow liquid or solid, depending on its form and purity. It is soluble in polar solvents like water and alcohols, which is indicative of its potential for hydrogen bonding due to the presence of nitrogen atoms in both the piperazine and pyrazole groups. The compound is of interest in medicinal chemistry, particularly for its potential biological activities, including effects on the central nervous system and interactions with various receptors. Its molecular structure allows for diverse chemical reactivity, making it a candidate for further functionalization in drug development. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken. Overall, 1-[2-(1H-Pyrazol-1-yl)ethyl]piperazine represents a versatile compound with potential applications in pharmaceuticals and research.

Formula: C₉H₁₆N₄

InChI: InChI=1S/C9H16N4/c1-2-11-13(5-1)9-8-12-6-3-10-4-7-12/h1-2,5,10H,3-4,6-9H2

InChI key: InChIKey=ZPTBMAUXTXJLDH-UHFFFAOYSA-N

SMILES: C(CN1C=CC=N1)N2CCNCC2

Synonyms:

• Piperazine, 1-[2-(1H-pyrazol-1-yl)ethyl]-
• 1-(2-Pyrazol-1-ylethyl)piperazine
• 1-[2-(1H-Pyrazol-1-yl)ethyl]piperazine

1-[2-(1H-pyrazol-1-yl)ethyl]piperazine

CAS: 381721-56-8

Formula: C₉H₁₆N₄

Purity: 95.0%

Color and Shape: Liquid, No data available.

Molecular weight: 180.255

Ref: 10-F496301