CAS 38186-87-7

6-Bromo-5-fluoro-3-pyridinecarboxylic acid

Description:

6-Bromo-5-fluoro-3-pyridinecarboxylic acid is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of bromine and fluorine substituents at the 6 and 5 positions, respectively, contributes to its unique chemical properties, including increased reactivity and potential for various chemical transformations. This compound features a carboxylic acid functional group at the 3-position, which imparts acidic characteristics and enhances its solubility in polar solvents. The molecular structure allows for potential applications in pharmaceuticals, agrochemicals, and as a building block in organic synthesis. Its reactivity can be influenced by the electronegative halogen atoms, making it suitable for nucleophilic substitution reactions. Additionally, the compound's properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity. Overall, 6-Bromo-5-fluoro-3-pyridinecarboxylic acid is a versatile compound with significant implications in various fields of chemistry.

Formula: C₆H₃BrFNO₂

InChI: InChI=1S/C6H3BrFNO2/c7-5-4(8)1-3(2-9-5)6(10)11/h1-2H,(H,10,11)

InChI key: InChIKey=YYLYQDSWERQSTR-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C(F)C(Br)=NC1

Synonyms:

• 6-Bromo-5-fluoro-3-pyridinecarboxylic acid
• 6-Bromo-5-fluoronicotinic acid
• 3-Pyridinecarboxylic acid, 6-bromo-5-fluoro-

5-fluoro-6-bromonicotinc acid

CAS: 38186-87-7

Formula: C₆H₃BrFNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 219.9959

Ref: IN-DA00CA7D

6-Bromo-5-fluoronicotinic acid

CAS: 38186-87-7

6-Bromo-5-fluoronicotinic acid

Formula: C₆H₃BrFNO₂

Purity: 97%

Color and Shape: white. lumpy powder

Molecular weight: 220.00g/mol

Ref: 54-PC305017

6-BROMO-5-FLUORONICOTINIC ACID

CAS: 38186-87-7

Formula: C₆H₃BrFNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 219.997

Ref: 10-F387043

6-Bromo-5-fluoronicotinic acid

CAS: 38186-87-7

Versatile small molecule scaffold

Formula: C₆H₃BrFNO₂

Purity: Min. 95%

Molecular weight: 220 g/mol

Ref: 3D-NBA18687