CAS 38186-88-8
:2-Chloro-5-fluoronicotinic acid
Description:
2-Chloro-5-fluoronicotinic acid is a heterocyclic organic compound characterized by the presence of both chlorine and fluorine substituents on a pyridine ring. It features a carboxylic acid functional group, which contributes to its acidic properties. The compound is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the carboxylic acid group. Its molecular structure includes a pyridine ring with a chlorine atom at the 2-position and a fluorine atom at the 5-position, which can influence its reactivity and interaction with biological systems. This compound is of interest in medicinal chemistry and pharmaceutical research, particularly for its potential applications in drug development, as the presence of halogens can enhance biological activity and modulate pharmacokinetic properties. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.
Formula:C6H3ClFNO2
InChI:InChI=1S/C6H3ClFNO2/c7-5-4(6(10)11)1-3(8)2-9-5/h1-2H,(H,10,11)
InChI key:InChIKey=WMADTZFXZAITIR-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(Cl)N=CC(F)=C1
Synonyms:- 1,1,1-Trifluorobutan-2-one
- 2-Butanone, 1,1,1-trifluoro-
- 2-Chloro-5-Fluoropyridine-3-Carboxylic Acid
- 2-Chloro-5-fluoro-3-pyridinecarboxylic acid
- 3-Pyridinecarboxylic acid, 2-chloro-5-fluoro-
- 2-Chloro-5-fluoronicotinic acid
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2-Chloro-5-fluoronicotinic acid
CAS:2-Chloro-5-fluoronicotinic acidFormula:C6H3ClFNO2Purity:techColor and Shape:SolidMolecular weight:175.544922-Chloro-5-fluoronicotinic acid
CAS:Formula:C6H3ClFNO2Purity:95%Color and Shape:SolidMolecular weight:175.54492-Chloro-5-fluoronicotinic acid
CAS:Formula:C6H3ClFNO2Purity:95%Color and Shape:SolidMolecular weight:175.542-Chloro-5-fluoronicotinic acid
CAS:2-Chloro-5-fluoronicotinic acidFormula:C6H3ClFNO2Purity:97%Molecular weight:175.542-Chloro-5-fluoropyridine-3-carboxylic acid
CAS:2-Chloro-5-fluoropyridine-3-carboxylic acid is an intermediate in the synthesis of fluorine compounds used in the industrial process. It can be synthesized by chlorinating 5-fluoropyridine with chlorine gas and a catalyst such as platinum, or by hydrogenating 2-chloro-5-pyridinecarboxylic acid. This chemical is used to manufacture other chemicals such as ethylene oxide, tetrafluoroethylene, and hexafluoroethane.
Formula:C6H3ClFNO2Purity:Min. 95%Molecular weight:175.54 g/mol




