CymitQuimica logo

CAS 38197-43-2

:

Benzene, 2-bromo-1-methoxy-3-methyl-

Description:
Benzene, 2-bromo-1-methoxy-3-methyl- (CAS 38197-43-2) is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a bromine atom, a methoxy group (-OCH3), and a methyl group (-CH3). The presence of the bromine atom introduces a halogen functionality, which can influence the compound's reactivity and polarity. The methoxy group is an electron-donating substituent that can enhance the compound's nucleophilicity, while the methyl group can affect steric hindrance and overall molecular stability. This compound is typically colorless to pale yellow and may have a characteristic aromatic odor. It is soluble in organic solvents and may exhibit moderate solubility in water due to the methoxy group. The compound's reactivity can be attributed to the electrophilic substitution reactions typical of aromatic compounds, making it useful in various chemical syntheses and applications in organic chemistry. Safety precautions should be taken when handling this compound, as it may pose health risks associated with brominated and aromatic compounds.
Formula:C8H9BrO
InChI:InChI=1S/C8H9BrO/c1-6-4-3-5-7(10-2)8(6)9/h3-5H,1-2H3
InChI key:ZPXCHEDAXFJYBZ-UHFFFAOYSA-N
SMILES:CC1=C(C(=CC=C1)OC)Br
Found 4 products.