CAS 382-31-0: 2,2,3,4,4,4-Hexafluoro-1-butanol
Description:2,2,3,4,4,4-Hexafluoro-1-butanol is a fluorinated alcohol characterized by its six fluorine atoms attached to a butanol backbone. This compound is notable for its high degree of fluorination, which imparts unique properties such as increased hydrophobicity and thermal stability. It is a colorless liquid at room temperature and has a relatively low volatility compared to non-fluorinated alcohols. The presence of multiple fluorine atoms enhances its chemical resistance, making it less reactive with many organic solvents and acids. Additionally, 2,2,3,4,4,4-Hexafluoro-1-butanol exhibits a high dielectric constant, which can be advantageous in various applications, including as a solvent or reagent in chemical synthesis. Its unique properties make it of interest in fields such as materials science, pharmaceuticals, and chemical manufacturing. However, due to environmental concerns associated with fluorinated compounds, its use may be subject to regulatory scrutiny. Proper handling and disposal practices are essential to mitigate any potential environmental impact.
Formula:C4H4F6O
InChI:InChI=1S/C4H4F6O/c5-2(4(8,9)10)3(6,7)1-11/h2,11H,1H2
InChI key:InChIKey=LVFXLZRISXUAIL-UHFFFAOYSA-N
SMILES:FC(C(F)(F)F)C(F)(F)CO
- Synonyms:
- (3R)-2,2,3,4,4,4-hexafluorobutan-1-ol
- (3S)-2,2,3,4,4,4-hexafluorobutan-1-ol
- 1-Butanol, 2,2,3,4,4,4-hexafluoro-
- 1H,1H,3H-Hexafluorobutanol
- 2,2,3,4,4,4-Hexafluoro-1-butyl alcohol
- 2,2,3,4,4,4-Hexafluorobutan-1-Ol
- 2,2,3,4,4,4-Hexafluorobutanol
- H 0649
- 2,2,3,4,4,4-Hexafluoro-1-butanol
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2,2,3,4,4,4-Hexafluoro-1-butanol REF: 3B-H0649CAS: 382-31-0 | >94.0%(GC) | 39.00 € | Wed 02 Apr 25 |
![]() | 2,2,3,4,4,4-Hexafluoro-1-butanol, 95% REF: 02-B20587CAS: 382-31-0 | 95% | To inquire | Thu 03 Apr 25 |
![]() | 2,2,3,4,4,4-Hexafluorobutan-1-ol REF: IN-DA003B2YCAS: 382-31-0 | 95% | 25.00 €~150.00 € | Wed 09 Apr 25 |
![]() | 2,2,3,4,4,4-Hexafluoro-1-butanol REF: 10-F002398CAS: 382-31-0 | 95.0% | To inquire | Mon 21 Apr 25 |
![]() | 2,2,3,4,4,4-Hexafluorobutan-1-ol REF: 54-PC4653CAS: 382-31-0 | 95% | - - - | Discontinued product |
![]() | 2,2,3,4,4,4-Hexafluoro-1-butanol REF: 3D-FH60453CAS: 382-31-0 | Min. 95% | - - - | Discontinued product |

2,2,3,4,4,4-Hexafluoro-1-butanol
Ref: 3B-H0649
25g | 39.00 € |

2,2,3,4,4,4-Hexafluoro-1-butanol, 95%
Ref: 02-B20587
100g | To inquire |

2,2,3,4,4,4-Hexafluorobutan-1-ol
Ref: IN-DA003B2Y
5g | 26.00 € | ||
25g | 25.00 € | ||
100g | 53.00 € | ||
500g | 150.00 € |

2,2,3,4,4,4-Hexafluoro-1-butanol
Ref: 10-F002398
5g | 29.00 € | ||
25g | To inquire |

2,2,3,4,4,4-Hexafluorobutan-1-ol
Ref: 54-PC4653
25g | Discontinued | Request information | |
100g | Discontinued | Request information | |
500g | Discontinued | Request information |

2,2,3,4,4,4-Hexafluoro-1-butanol
Ref: 3D-FH60453
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
50g | Discontinued | Request information | |
100g | Discontinued | Request information | |
250g | Discontinued | Request information |