CAS 382-44-5
:11β-Hydroxyandrost-4-ene-3,17-dione
Description:
11β-Hydroxyandrost-4-ene-3,17-dione, commonly referred to as 11-hydroxyandrostenedione, is a steroid hormone and an important intermediate in the biosynthesis of androgens. It is characterized by its structure, which includes a hydroxyl group at the 11β position and a ketone group at both the 3 and 17 positions of the steroid nucleus. This compound plays a significant role in the regulation of various physiological processes, including muscle growth and metabolism. It is often studied in the context of its potential anabolic effects and its influence on testosterone levels. The substance is typically found in the form of a white to off-white crystalline powder and is soluble in organic solvents. Its use is regulated in many sports due to its performance-enhancing properties. Additionally, 11β-Hydroxyandrost-4-ene-3,17-dione can be synthesized through various chemical pathways, making it a subject of interest in both pharmaceutical and biochemical research.
Formula:C19H26O3
InChI:InChI=1S/C19H26O3/c1-18-8-7-12(20)9-11(18)3-4-13-14-5-6-16(22)19(14,2)10-15(21)17(13)18/h9,13-15,17,21H,3-8,10H2,1-2H3/t13-,14-,15-,17+,18-,19-/m0/s1
InChI key:InChIKey=WSCUHXPGYUMQEX-KCZNZURUSA-N
SMILES:C[C@@]12[C@@]3([C@]([C@]4([C@](C)(C[C@@H]3O)C(=O)CC4)[H])(CCC1=CC(=O)CC2)[H])[H]
Synonyms:- Androst-4-ene-3,17-dione, 11β-hydroxy-
- Androst-4-ene-3,17-dione, 11-hydroxy-, (11β)-
- Δ4-Androsten-11β-ol-3,17-dione
- 11β-Hydroxy-Δ4-androstene-3,17-dione
- (11β)-11-Hydroxyandrost-4-ene-3,17-dione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
11β-Hydroxy Androstenedione (11β-Hydroxyandrost-4-ene-3,17-dione)
CAS:Ketone-alcohols and ketone-aldehydes, nesoiFormula:C19H26O3Color and Shape:White PowderMolecular weight:302.1881911-β-hydroxyandrostenedione
CAS:11-Beta-hydroxyandrostenedione (NSC-17102), adrenal steroid, inhibits 11β-hydroxysteroid dehydrogenase; used to trace hyperandrogenism sources.Formula:C19H26O3Purity:98.96%Color and Shape:SolidMolecular weight:302.41Ref: TM-T14001
5mg47.00€10mg70.00€25mg126.00€50mg197.00€100mg298.00€500mg715.00€1mL*10mM (DMSO)50.00€4-Androsten-11Beta-ol-3,17-dione
CAS:Controlled ProductApplications 4-Androsten-11β-ol-3,17-dione is a steroid hormone. An analog of Androstenedione (A637550).
References Grosser, B. et al.: Steroids. 8, 915 (1966);Formula:C19H26O3Color and Shape:White To Off-WhiteMolecular weight:302.414-Androsten-11beta-ol-3,17-dione
CAS:Controlled Product4-Androsten-11beta-ol-3,17-dione is a steroidal compound, often investigated for its potential as a precursor in the biosynthesis of other steroid hormones. This chemical is sourced from synthetic pathways where it is derived through chemical synthesis rather than extraction from natural origins. Its mode of action primarily involves the conversion into other biologically active steroids that may influence various physiological processes.
Formula:C19H26O3Purity:Min. 95 Area-%Color and Shape:White PowderMolecular weight:302.41 g/mol4-Androsten-11b-ol-3,17-dione (1 mg/ml in Acetonitrile)
CAS:Controlled ProductFormula:C19H26O3Color and Shape:Single SolutionMolecular weight:302.4111b-Hydroxy-androst-4-ene-3,17-dione
CAS:Formula:C19H26O3Purity:98%Color and Shape:SolidMolecular weight:302.4079








