CAS 38220-75-6

2-Acetyl-5-bromobenzo[b]furan

Description:

2-Acetyl-5-bromobenzo[b]furan is an organic compound characterized by its unique structure, which includes a furan ring fused to a benzene ring, along with an acetyl group and a bromine substituent. This compound typically exhibits a molecular formula that reflects its complex structure, contributing to its chemical properties. It is generally a solid at room temperature and may appear as a crystalline or powder form. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical reactions, including electrophilic substitutions. The acetyl group enhances its solubility in organic solvents and can influence its reactivity in condensation reactions. Additionally, 2-acetyl-5-bromobenzo[b]furan may exhibit biological activity, which could be of interest in pharmaceutical research. Its synthesis often involves multi-step organic reactions, and it can be analyzed using techniques such as NMR and mass spectrometry to confirm its structure and purity. Overall, this compound is significant in organic chemistry and may have applications in materials science and medicinal chemistry.

Formula: C₁₀H₇BrO₂

InChI: InChI=1/C10H7BrO2/c1-6(12)10-5-7-4-8(11)2-3-9(7)13-10/h2-5H,1H3

SMILES: CC(=O)c1cc2cc(ccc2o1)Br

Synonyms:

• 1-(5-Bromo-1-Benzofuran-2-Yl)Ethanone
• Ethanone, 1-(5-Bromo-2-Benzofuranyl)-

1-(5-Bromobenzofuran-2-yl)ethanone

CAS: 38220-75-6

Formula: C₁₀H₇BrO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 239.0654

Ref: IN-DA003D16

1-(5-Bromo-1-benzofuran-2-yl)ethanone

CAS: 38220-75-6

1-(5-Bromo-1-benzofuran-2-yl)ethanone

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 239.07g/mol

Ref: 54-OR110915

1-(5-bromo-1-benzofuran-2-yl)ethanone

CAS: 38220-75-6

Formula: C₁₀H₇BrO₂

Purity: 98%

Molecular weight: 239.068

Ref: 10-F358019

1-(5-Bromo-1-benzofuran-2-yl)ethanone

CAS: 38220-75-6

1-(5-Bromo-1-benzofuran-2-yl)ethanone (5BBF) is an activated brominated benzofuran derivative. It has been shown to inhibit the formation of heterocyclic amines, which are known to be carcinogenic. 5BBF also inhibits the activation of chalcone into chloroacetone by cross-coupling reactions with hydrochloric acid and ethylidene chloride. This compound is a potential candidate for the prevention of cancer from dietary sources due to its ability to inhibit the formation of carcinogens in food.

Formula: C₁₀H₇BrO₂

Purity: Min. 95%

Molecular weight: 239.07 g/mol

Ref: 3D-NBA22075