CAS 38226-86-7: β-Anhydroicaritin
Description:β-Anhydroicaritin is a flavonoid compound that belongs to the class of natural products known as flavonoids, which are widely distributed in the plant kingdom. It is characterized by its unique chemical structure, which includes a flavone backbone with specific hydroxyl and methoxy groups that contribute to its biological activity. This compound is known for its potential pharmacological properties, including antioxidant, anti-inflammatory, and anticancer activities. β-Anhydroicaritin has been studied for its effects on various cellular pathways, making it of interest in medicinal chemistry and pharmacology. Additionally, it is often extracted from traditional medicinal plants, highlighting its significance in herbal medicine. The compound's solubility, stability, and reactivity can vary depending on environmental conditions, which are important factors to consider in both laboratory and therapeutic applications. Overall, β-Anhydroicaritin represents a promising area of research due to its diverse biological activities and potential health benefits.
Formula:C21H20O6
InChI:InChI=1S/C21H20O6/c1-21(2)9-8-13-15(27-21)10-14(22)16-17(23)18(24)19(26-20(13)16)11-4-6-12(25-3)7-5-11/h4-7,10,22,24H,8-9H2,1-3H3
InChI key:InChIKey=PPCHTBBOSVKORE-UHFFFAOYSA-N
SMILES:O=C1C(O)=C(OC=2C1=C(O)C=C3OC(C)(C)CCC32)C=4C=CC(OC)=CC4
- Synonyms:
- 3,5-Dihydroxy-2-(4-methoxyphenyl)-8,8-dimethyl-9,10-dihydropyrano[2,3-h]chromen-4-one
- 4H,8H-Benzo[1,2-b:3,4-b']dipyran-4-one, 9,10-dihydro-3,5-dihydroxy-2-(4-methoxyphenyl)-8,8-dimethyl-
- 4H-1-benzopyran-4-one, 3,5,7-trihydroxy-2-(4-methoxyphenyl)-8-(3-methyl-2-buten-1-yl)-
- 9,10-Dihydro-3,5-dihydroxy-2-(4-methoxyphenyl)-8,8-dimethyl-4H,8H-benzo[1,2-b:3,4-b′]dipyran-4-one
- Anhydroicaritin
- Anhydroicaritin, β-
- Cycloicaritin
- Icaritin
- Icaritin, b-anhydro-
- b-Anhydroicaritin
- See more synonyms
