CAS 3823-40-3
:3-(Trifluoromethylthio)phenol
Description:
3-(Trifluoromethylthio)phenol, with the CAS number 3823-40-3, is an organic compound characterized by the presence of a trifluoromethylthio group attached to a phenolic structure. This compound features a phenol ring, which is a benzene ring with a hydroxyl (-OH) group, and a trifluoromethylthio group (-SCF3) that significantly influences its chemical properties. The trifluoromethylthio group is known for its electron-withdrawing characteristics, which can enhance the acidity of the phenolic hydroxyl group and affect the compound's reactivity. 3-(Trifluoromethylthio)phenol is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its unique structure makes it of interest in various fields, including pharmaceuticals and agrochemicals, where it may serve as an intermediate or a building block for more complex molecules. Additionally, the presence of fluorine atoms can impart unique physical and chemical properties, such as increased stability and altered lipophilicity, which can be advantageous in drug design and development.
Formula:C7H5F3OS
InChI:InChI=1/C7H5F3OS/c8-7(9,10)12-6-3-1-2-5(11)4-6/h1-4,11H
SMILES:c1cc(cc(c1)SC(F)(F)F)O
Synonyms:- 3-[(Trifluoromethyl)-mercapto]-phenol
- 3-[(Trifluoromethyl)Sulfanyl]Phenol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-(TRIFLUOROMETHYLTHIO)PHENOL
CAS:Formula:C7H5F3OSPurity:95%Color and Shape:SolidMolecular weight:194.17423-(Trifluoromethylthio)phenol
CAS:<p>3-(Trifluoromethylthio)phenol</p>Purity:95%Molecular weight:194.17g/mol3-(Trifluoromethylthio)phenol
CAS:<p>3-(Trifluoromethylthio)phenol is a high quality reagent that is used as a building block in the synthesis of complex compounds. It has been shown to be an intermediate for the production of fine chemicals and research chemicals, as well as being used as a versatile building block in reactions with other chemical substances. 3-(Trifluoromethylthio)phenol has CAS No. 3823-40-3 and is useful for a wide range of applications, and can be used in the production of speciality chemicals.</p>Formula:C7H5F3OSPurity:Min. 95%Color and Shape:Off-White PowderMolecular weight:194.18 g/mol3-(TRIFLUOROMETHYLTHIO)PHENOL
CAS:Formula:C7H5F3OSPurity:95%Color and Shape:Solid, PowderMolecular weight:194.173-[(Trifluoromethyl)thio]phenol
CAS:Controlled Product<p>Applications 3-[(Trifluoromethyl)thio]phenol is a reactant used in the preparation of 2-azolyl-4-phenoxypyrimidines as highly active herbicides that inhibit carotenoid biosynthesis.<br>References Selby, T.P., et. al.: ACS Symposium Series, 800, 74 (2002)<br></p>Formula:C7H5F3OSColor and Shape:NeatMolecular weight:194.17




