CAS 38232-08-5

Gaylussacin

Description:

Gaylussacin is a chemical compound that belongs to the class of alkaloids, specifically derived from the plant species of the genus "Gaylussacia." It is characterized by its unique molecular structure, which includes a bicyclic framework. The compound is known for its potential biological activities, including antimicrobial and anti-inflammatory properties, although detailed studies on its pharmacological effects are still limited. Gaylussacin is typically isolated from natural sources, and its extraction often involves various organic solvents. The compound's solubility can vary depending on the solvent used, which is an important consideration for its applications in research and potential therapeutic uses. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature. As with many natural products, further research is necessary to fully understand its mechanisms of action and potential applications in medicine or agriculture. Overall, Gaylussacin represents an interesting subject for further exploration in the field of natural product chemistry.

Formula: C₂₁H₂₂O₉

InChI: InChI=1S/C21H22O9/c22-10-15-17(24)18(25)19(26)21(30-15)29-13-8-12(16(20(27)28)14(23)9-13)7-6-11-4-2-1-3-5-11/h1-9,15,17-19,21-26H,10H2,(H,27,28)/b7-6+/t15-,17-,18+,19-,21-/m1/s1

InChI key: InChIKey=UPCRMPLOWXXPFK-BNVRZUOOSA-N

SMILES: C(=C/C1=CC=CC=C1)\C2=C(C(O)=O)C(O)=CC(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)=C2

Synonyms:

• Gaylussacin
• 4-(β-D-Glucopyranosyloxy)-2-hydroxy-6-[(1E)-2-phenylethenyl]benzoic acid
• Benzoic acid, 4-(β-D-glucopyranosyloxy)-2-hydroxy-6-[(1E)-2-phenylethenyl]-
• Benzoic acid, 4-(β-D-glucopyranosyloxy)-2-hydroxy-6-(2-phenylethenyl)-, (E)-

Gaylussacin

CAS: 38232-08-5

Gaylussacin is a natural product that can be used as a reference standard. The CAS number of Gaylussacin is 38232-08-5.

Formula: C₂₁H₂₂O₉

Color and Shape: Solid

Molecular weight: 418.398

Ref: TM-T124925