CAS 38239-45-1
:5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine
Description:
5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine is a heterocyclic compound characterized by its fused triazole and pyrazine rings, which contribute to its unique chemical properties. This compound typically exhibits a bicyclic structure that enhances its stability and reactivity. It is a colorless to pale yellow solid at room temperature and is soluble in polar organic solvents. The presence of nitrogen atoms in its structure often imparts basicity and potential for hydrogen bonding, making it interesting for various chemical reactions and applications. This compound may exhibit biological activity, which has led to research in medicinal chemistry, particularly in the development of pharmaceuticals. Its structural features allow for potential interactions with biological targets, making it a candidate for further investigation in drug discovery. As with many nitrogen-containing heterocycles, it may also participate in coordination chemistry, forming complexes with metal ions. Overall, 5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine is a versatile compound with significant implications in both synthetic and medicinal chemistry.
Formula:C6H5BrO2S
InChI:InChI=1/C6H5BrO2S/c1-3-2-4(7)10-5(3)6(8)9/h2H,1H3,(H,8,9)
SMILES:Cc1cc(Br)sc1C(=O)O
Synonyms:- 5-Bromo-3-Methylthiophene-2-Carboxylic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-Bromo-3-methylthiophene-2-carboxylic acid
CAS:Formula:C6H5BrO2SPurity:97%Color and Shape:SolidMolecular weight:221.07175-Bromo-3-methylthiophene-2-carboxylic acid
CAS:5-Bromo-3-methylthiophene-2-carboxylic acidPurity:97%Molecular weight:221.07g/mol5-Bromo-3-methylthiophene-2-carboxylic acid
CAS:Formula:C6H5BrO2SPurity:97%Color and Shape:SolidMolecular weight:221.075-Bromo-3-methylthiophene-2-carboxylic acid
CAS:5-bromo-3-methylthiophene-2-carboxylic acid (5BmtCA) is a potential therapeutic that has been shown to have the same estrogenic activity as estradiol. It may be used for the treatment of osteoporosis and other conditions associated with estrogen deficiency, including resorption and bone loss. 5BmtCA is an amide with two phenyl groups at the C3 position, which are bioisosteres of the sulfur in estradiol. The substitutions on these phenyl groups can be changed to produce analogs with different properties. For example, 5BmtCA may be substituted with a ketone group at position C3 to produce the corresponding ketone analog 5BmtCK. This compound would be expected to have reduced bone resorption activity relative to 5BmtCA.Formula:C6H5BrO2SPurity:Min. 95%Color and Shape:PowderMolecular weight:221.07 g/mol



