CAS 3824-21-3

2-fluoro-4-iodo-1-methoxybenzene

Description:

2-Fluoro-4-iodo-1-methoxybenzene, also known by its CAS number 3824-21-3, is an aromatic compound characterized by the presence of a methoxy group (-OCH3), a fluorine atom, and an iodine atom attached to a benzene ring. This compound exhibits typical properties of halogenated aromatic compounds, including moderate to low solubility in water and higher solubility in organic solvents such as ethanol and dichloromethane. The presence of both fluorine and iodine introduces unique reactivity patterns, making it useful in various chemical synthesis applications, particularly in medicinal chemistry and materials science. The methoxy group can influence the electron density of the aromatic ring, affecting its reactivity and interactions with other chemical species. Additionally, the compound may exhibit interesting physical properties such as specific melting and boiling points, which are influenced by the substituents on the benzene ring. Overall, 2-fluoro-4-iodo-1-methoxybenzene serves as a valuable intermediate in organic synthesis and research.

Formula: C₇H₆FIO

InChI: InChI=1/C7H6FIO/c1-10-7-3-2-5(9)4-6(7)8/h2-4H,1H3

SMILES: COc1ccc(cc1F)I

Synonyms:

• 2-Fluoro-4-iodophenyl methyl ether
• Benzene, 2-fluoro-4-iodo-1-methoxy-
• 2-Fluoro-4-iodoanisole

Benzene, 2-fluoro-4-iodo-1-Methoxy-

CAS: 3824-21-3

Formula: C₇H₆FIO

Purity: 97%

Color and Shape: Solid

Molecular weight: 252.0248

Ref: IN-DA00C6NT

2-Fluoro-4-iodo-1-methoxybenzene

CAS: 3824-21-3

2-Fluoro-4-iodo-1-methoxybenzene

Purity: 97%

Molecular weight: 252.02g/mol

Ref: 54-PC903918

2-Fluoro-4-iodoanisole

CAS: 3824-21-3

Formula: C₇H₆FIO

Purity: 97%

Color and Shape: Liquid

Molecular weight: 252.027

Ref: 10-F038782