CymitQuimica logo

CAS 38254-66-9

:

N,N,N',N'-Tetramethyl-L-Cystine

Description:
N,N,N',N'-Tetramethyl-L-Cystine is a synthetic compound characterized by its unique structure, which includes two cysteine residues linked by a disulfide bond, with each nitrogen atom in the amino group being substituted by a methyl group. This modification enhances its solubility and stability compared to its parent amino acid, cysteine. The compound is typically used in biochemical research, particularly in studies involving protein folding, redox reactions, and the role of thiol groups in biological systems. It exhibits properties typical of thiol-containing compounds, such as the ability to participate in redox reactions and form disulfide bonds. Additionally, due to its tetramethylated structure, it may exhibit altered reactivity and interaction with other biomolecules. As with many sulfur-containing compounds, it can have implications in various biological processes, including antioxidant activity. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during use.
Formula:C10H20N2O4S2
InChI:InChI=1/C10H20N2O4S2/c1-11(2)7(9(13)14)5-17-18-6-8(10(15)16)12(3)4/h7-8H,5-6H2,1-4H3,(H,13,14)(H,15,16)/t7-,8-/m0/s1
SMILES:CN(C)[C@@H](CSSC[C@@H](C(=O)O)N(C)C)C(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.