CAS 38274-00-9

(6S,7aS)-5,6,7,7a-Tetrahydro-6-hydroxy-4,4,7a-trimethyl-2(4H)-benzofuranone

Description:

The chemical substance known as (6S,7aS)-5,6,7,7a-Tetrahydro-6-hydroxy-4,4,7a-trimethyl-2(4H)-benzofuranone, with the CAS number 38274-00-9, is a bicyclic compound characterized by its complex structure that includes a benzofuranone moiety. This compound features a tetrahydro structure, indicating the presence of a saturated ring system, and it contains multiple methyl groups, which contribute to its hydrophobic characteristics. The presence of a hydroxyl group (–OH) suggests that it may exhibit polar properties, potentially influencing its solubility and reactivity. The stereochemistry, denoted by the (6S,7aS) configuration, indicates specific spatial arrangements of atoms, which can significantly affect the compound's biological activity and interactions. Such compounds are often of interest in medicinal chemistry and natural product synthesis due to their potential therapeutic properties. Overall, this substance exemplifies the complexity and diversity of organic compounds, particularly those derived from natural sources.

Formula: C₁₁H₁₆O₃

InChI: InChI=1S/C11H16O3/c1-10(2)5-7(12)6-11(3)8(10)4-9(13)14-11/h4,7,12H,5-6H2,1-3H3/t7-,11-/m0/s1

InChI key: InChIKey=XEVQXKKKAVVSMW-CPCISQLKSA-N

SMILES: C[C@@]12C(C(C)(C)C[C@H](O)C1)=CC(=O)O2

Synonyms:

• (+)-Epiloliolide
• 2(4H)-Benzofuranone, 5,6,7,7a-tetrahydro-6-hydroxy-4,4,7a-trimethyl-, (6S-trans)-
• (6S,7aS)-5,6,7,7a-Tetrahydro-6-hydroxy-4,4,7a-trimethyl-2(4H)-benzofuranone
• Isololiolide
• 2(4H)-Benzofuranone, 5,6,7,7a-tetrahydro-6-hydroxy-4,4,7a-trimethyl-, (6S,7aS)-

Isololiolide

CAS: 38274-00-9

Isololiolide is phytotoxic, anti-Trypanosoma, an ARE inducer, anti-inflammatory, cytotoxic to HepG2, and induces apoptosis. IC50: 32-40 μM.

Formula: C₁₁H₁₆O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 196.24

Ref: TM-TN6501

Isololiolide

CAS: 38274-00-9

Isololiolide is a naturally occurring compound, which is primarily classified as a sesquiterpene lactone. It is derived from various plant sources, notably marine algae and certain terrestrial plants. The mode of action of isololiolide is associated with its potent antioxidant properties, achieved by scavenging free radicals and reducing oxidative stress at the cellular level. Additionally, isololiolide exhibits anti-inflammatory activity, modulating various signaling pathways that involve pro-inflammatory mediators.

Formula: C₁₁H₁₆O₃

Purity: Min. 95%

Molecular weight: 196.24 g/mol

Ref: 3D-NBA27400