CymitQuimica logo

CAS 38274-16-7

:

1-Bromo-2-[2-(trimethylsilyl)ethynyl]benzene

Description:
1-Bromo-2-[2-(trimethylsilyl)ethynyl]benzene is an organic compound characterized by its bromobenzene structure, where a bromine atom is substituted at the second position of a benzene ring. The compound features a trimethylsilyl group attached to an ethynyl group at the para position relative to the bromine. This structure imparts unique properties, including increased stability and solubility in organic solvents due to the presence of the trimethylsilyl group, which also enhances its reactivity in various chemical reactions, such as cross-coupling reactions. The ethynyl group contributes to the compound's potential applications in organic synthesis and materials science. Additionally, the presence of the bromine atom allows for further functionalization, making it a versatile intermediate in the synthesis of more complex organic molecules. The compound is typically handled with standard safety precautions due to the presence of bromine, which can be hazardous. Overall, 1-Bromo-2-[2-(trimethylsilyl)ethynyl]benzene is a valuable compound in synthetic organic chemistry.
Formula:C11H13BrSi
InChI:InChI=1S/C11H13BrSi/c1-13(2,3)9-8-10-6-4-5-7-11(10)12/h4-7H,1-3H3
InChI key:InChIKey=FABNGXSCLHXUOH-UHFFFAOYSA-N
SMILES:C(#C[Si](C)(C)C)C1=C(Br)C=CC=C1
Synonyms:
  • 1-Bromo-2-[2-(trimethylsilyl)ethynyl]benzene
  • Silane, [(2-bromophenyl)ethynyl]trimethyl-
  • 1-Bromo-2-[(trimethylsilyl)ethynyl]benzene
  • [(o-Bromophenyl)ethynyl]trimethylsilane
  • Benzene, 1-bromo-2-[2-(trimethylsilyl)ethynyl]-
Found 6 products.