CymitQuimica logo

CAS 38275-55-7

:

5-Fluoro-2-pyrimidinecarbonitrile

Description:
5-Fluoro-2-pyrimidinecarbonitrile is a heterocyclic organic compound characterized by its pyrimidine ring structure, which contains a fluorine atom and a cyano group (-C≡N) at specific positions. The presence of the fluorine atom typically enhances the compound's reactivity and can influence its biological activity, making it of interest in pharmaceutical research. The cyano group contributes to the compound's polarity and can participate in various chemical reactions, such as nucleophilic additions. This compound is often utilized in the synthesis of other organic molecules and may serve as an intermediate in the production of agrochemicals or pharmaceuticals. Its molecular structure allows for potential interactions with biological targets, which is valuable in drug design. Additionally, 5-Fluoro-2-pyrimidinecarbonitrile is likely to exhibit moderate solubility in polar solvents, and its stability can be influenced by environmental conditions such as temperature and pH. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C5H2FN3
InChI:InChI=1S/C5H2FN3/c6-4-2-8-5(1-7)9-3-4/h2-3H
InChI key:InChIKey=GAIUVAWQVCEHIS-UHFFFAOYSA-N
SMILES:C(#N)C=1N=CC(F)=CN1
Synonyms:
  • 2-Cyano-5-fluoropyrimidine
  • 2-Pyrimidinecarbonitrile, 5-fluoro-
  • 5-Fluoropyrimidine-2-Carbonitrile
  • 5-Fluoro-2-pyrimidinecarbonitrile
Found 4 products.