CAS 38275-56-8

5-chloropyrimidine-2-carbonitrile

Description:

5-Chloropyrimidine-2-carbonitrile is a heterocyclic organic compound characterized by a pyrimidine ring substituted with a chlorine atom and a cyano group. The molecular structure consists of a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3, with a chlorine substituent at position 5 and a cyano group (-C≡N) at position 2. This compound is typically a colorless to pale yellow solid and is soluble in polar organic solvents. It exhibits properties typical of pyrimidine derivatives, including potential reactivity in nucleophilic substitution reactions due to the presence of the cyano group. The chlorine atom can influence the compound's electronic properties and reactivity, making it useful in various synthetic applications, particularly in the pharmaceutical and agrochemical industries. Additionally, 5-chloropyrimidine-2-carbonitrile may serve as an intermediate in the synthesis of more complex molecules, contributing to its significance in organic chemistry. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₅H₂ClN₃

InChI: InChI=1/C5H2ClN3/c6-4-2-8-5(1-7)9-3-4/h2-3H

SMILES: C(#N)c1ncc(cn1)Cl

Synonyms:

• 2-Pyrimidinecarbonitrile, 5-chloro- (9CI)
• 5-Chloro-2-pyrimidinecarbonitrile

2-Pyrimidinecarbonitrile, 5-chloro- (9CI)

CAS: 38275-56-8

Formula: C₅H₂ClN₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 139.5425

Ref: IN-DA00C09G

5-Chloropyrimidine-2-carbonitrile

CAS: 38275-56-8

5-Chloropyrimidine-2-carbonitrile

Purity: 98%

Color and Shape: Solid

Molecular weight: 139.54g/mol

Ref: 54-OR346523

5-Chloropyrimidine-2-carbonitrile

CAS: 38275-56-8

Formula: C₅H₂ClN₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 139.54

Ref: 10-F077649