
CAS 38279-34-4
:Dodecanedial
Description:
Dodecanedial, also known as dodecanal or lauric aldehyde, is an organic compound characterized by its long carbon chain, specifically containing twelve carbon atoms and two aldehyde functional groups at each end of the molecule. Its chemical formula is C12H24O2, and it belongs to the class of aliphatic aldehydes. Dodecanedial is typically a colorless to pale yellow liquid with a fatty odor, reflecting its structure derived from lauric acid. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. The compound is used in various applications, including as a flavoring agent, in the synthesis of other chemicals, and in the production of surfactants. Dodecanedial can undergo typical aldehyde reactions, such as oxidation to form carboxylic acids or condensation reactions. Its properties make it relevant in both industrial and research settings, particularly in the fields of organic synthesis and materials science. Safety precautions should be observed when handling this compound, as with many aldehydes, due to potential irritant effects.
Formula:C12H22O2
InChI:InChI=1S/C12H22O2/c13-11-9-7-5-3-1-2-4-6-8-10-12-14/h11-12H,1-10H2
InChI key:InChIKey=SZCGBFUWBCDIEA-UHFFFAOYSA-N
SMILES:C(CCCCCC=O)CCCCC=O
Synonyms:- Dodecanedialdehyde
- 1,12-Dodecanedialdehyde
- Dodecanedial
- 1,12-Dodecanedial
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Dodecanedial
CAS:<p>Dodecanedial is a biological compound that is activated by radiation and has been shown to have cancer-fighting properties. Dodecanedial can be used in the synthesis of polyvinyl alcohol, which is used in the production of vinyl alcohol, a precursor for many organic compounds. Dodecanedial binds to insulin receptors and has been shown to prevent the development of insulin resistance. It also inhibits pancreatitis by suppressing lipase activity. Dodecanedial has been shown to react with potassium phosphate, forming dodecane-1,2-diolate potassium phosphate. This reaction vessel is an important step in the synthesis of various biologically active compounds such as insulin and thyroxine.</p>Formula:C12H22O2Purity:Min. 95%Molecular weight:198.3 g/mol
