CAS 38289-30-4

trans-4-Hexylcyclohexanecarboxylic acid

Description:

Trans-4-Hexylcyclohexanecarboxylic acid is an organic compound characterized by its cyclohexane ring structure substituted with a hexyl group and a carboxylic acid functional group. This compound typically exhibits a solid state at room temperature and is known for its relatively high melting point due to the presence of the carboxylic acid, which can engage in hydrogen bonding. The trans configuration of the hexyl group relative to the carboxylic acid influences its physical properties, such as solubility and melting behavior. It is generally soluble in organic solvents but has limited solubility in water. The compound may be of interest in various applications, including materials science and organic synthesis, due to its unique structural features. Additionally, its properties can be influenced by factors such as temperature and the presence of other chemical species. As with many organic acids, it may exhibit acidic behavior in solution, contributing to its reactivity in chemical reactions.

Formula: C₁₃H₂₄O₂

InChI: InChI=1/C13H24O2/c1-2-3-4-5-6-11-7-9-12(10-8-11)13(14)15/h11-12H,2-10H2,1H3,(H,14,15)/t11-,12-

InChI key: InChIKey=POEBGIQSFIJHAX-HAQNSBGRNA-N

SMILES: C(O)(=O)[C@H]1CC[C@H](CCCCCC)CC1

Synonyms:

• 4-Hexylcyclohexanecarboxylic acid
• Cyclohexanecarboxylic Acid, 4-Hexyl-
• Cyclohexanecarboxylic acid, 4-hexyl-, trans-
• trans-4-Hexylcyclohexane-1-carboxylic acid
• trans-p-Hexylcyclohexane carboxylic acid
• trans-4-Hexylcyclohexanecarboxylic acid