CAS 383-70-0
:N-(Trifluoroacetyl)aminoacetic acid
Description:
N-(Trifluoroacetyl)aminoacetic acid, also known as TFAA, is an organic compound characterized by the presence of both an amino group and a trifluoroacetyl functional group. Its molecular structure features a central carbon backbone with an amino group (-NH2) and a trifluoroacetyl group (-C(=O)CF3) attached, which contributes to its unique chemical properties. This compound is typically a white crystalline solid at room temperature and is soluble in polar solvents such as water and alcohols due to the presence of the amino group. TFAA is known for its reactivity, particularly in acylation reactions, where it can serve as a reagent in organic synthesis. The trifluoroacetyl group enhances the electrophilicity of the carbonyl carbon, making it a useful intermediate in the synthesis of various pharmaceuticals and agrochemicals. Additionally, the presence of fluorine atoms imparts distinctive physical and chemical properties, such as increased lipophilicity and stability against hydrolysis. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C4H4F3NO3
InChI:InChI=1/C4H4F3NO3/c5-4(6,7)3(11)8-1-2(9)10/h1H2,(H,8,11)(H,9,10)
SMILES:C(C(=O)O)N=C(C(F)(F)F)O
Synonyms:- Trifluoroacetyl Glycine
- N-(Trifluoroacetyl)Glycine
- N-Alpha-Trifluoroacetyl-Glycine
- Tfa-Glycine
- Tfa-Gly-Oh
- [(Trifluoroacetyl)amino]acetic acid
- glycine,N-(trifluoroacetyl)-
- N-alpha-Trifluoracetyl-glycin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Tfa-Gly-OH
CAS:Bachem ID: 4002918.
Formula:C4H4F3NO3Purity:> 99%Color and Shape:White Crystalline PowderMolecular weight:171.08N-(Trifluoroacetyl)glycine
CAS:N-(Trifluoroacetyl)glycine is an amide with a trifluoroacetyl group. It is used in the synthesis of hydrophilic compounds and as a linker for other molecules. N-(Trifluoroacetyl)glycine has been shown to be toxic to the kidneys, which may be due to its ability to inhibit the conversion of glycine to urea by the enzyme glycine-N-acyltransferase. This drug also has antiviral activity against HIV infection, particularly when combined with other antiviral drugs such as zidovudine or lamivudine.Formula:C4H4F3NO3Purity:Min. 95%Color and Shape:White Off-White PowderMolecular weight:171.07 g/molN-Trifluoroacetylglycine
CAS:Controlled ProductFormula:C4H4F3NO3Color and Shape:NeatMolecular weight:171.072-(2,2,2-Trifluoroacetamido)acetic acid
CAS:Formula:C4H4F3NO3Purity:97%Color and Shape:SolidMolecular weight:171.075





