CAS 38309-60-3
:3H-spiro[isobenzofuran-1,4'-piperidine]
Description:
3H-spiro[isobenzofuran-1,4'-piperidine], with the CAS number 38309-60-3, is a chemical compound characterized by its unique spirocyclic structure, which consists of a piperidine ring fused to an isobenzofuran moiety. This compound exhibits a complex arrangement of atoms, contributing to its potential biological activity and chemical reactivity. The presence of both aromatic and aliphatic components in its structure may influence its solubility, stability, and interaction with biological targets. Typically, compounds like this can be of interest in medicinal chemistry due to their potential pharmacological properties, including analgesic or psychoactive effects. The spiro configuration often leads to unique conformational properties, which can affect how the molecule interacts with enzymes or receptors in biological systems. Additionally, the compound's synthesis and characterization would involve standard organic chemistry techniques, including spectroscopic methods for structural elucidation. Overall, 3H-spiro[isobenzofuran-1,4'-piperidine] represents a fascinating subject for further research in both synthetic and medicinal chemistry.
Formula:C12H15NO
InChI:InChI=1/C12H15NO/c1-2-4-11-10(3-1)9-14-12(11)5-7-13-8-6-12/h1-4,13H,5-9H2
SMILES:c1ccc2c(c1)COC12CCNCC1
Synonyms:- 3H-Spiro[2-benzofuran-1,4'-piperidine]
- spiro[isobenzofuran-1(3H),4'-piperidine]
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3H-Spiro[2-benzofuran-1,4'-piperidine]
CAS:Formula:C12H15NOPurity:95%Color and Shape:SolidMolecular weight:189.25363H-Spiro[2-benzofuran-1,4'-piperidine]
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:189.25799560546875Ref: 10-F076574
1gTo inquire2gTo inquire5gTo inquire10gTo inquire100mgTo inquire250mgTo inquire500mgTo inquire3H-Spiro[2-benzofuran-1,4'-piperidine]
CAS:3H-Spiro[2-benzofuran-1,4'-piperidine] is a ligand with affinity for melanocortin receptors. It has been shown to bind with low affinity to the melanocortin receptor and act as an agonist. 3H-Spiro[2-benzofuran-1,4'-piperidine] has high affinity for benzene, which may be due to its ring system. This ligand also has a penetrable structure that allows it to bind to piperidine binding sites.
Formula:C12H15NO·HClPurity:Min. 95%Molecular weight:225.71 g/mol


