CAS 38309-89-6
:2,7-bis(bromomethyl)naphthalene
Description:
2,7-bis(bromomethyl)naphthalene is an organic compound characterized by its naphthalene backbone, which features two bromomethyl groups attached at the 2 and 7 positions. This structure contributes to its reactivity and potential applications in organic synthesis, particularly in the formation of more complex molecules through cross-coupling reactions. The presence of bromine atoms enhances its electrophilic character, making it a useful intermediate in various chemical transformations. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its physical properties, such as melting point and boiling point, can vary based on purity and specific conditions. Additionally, due to the presence of bromine, it may pose certain hazards, including toxicity and environmental concerns, necessitating careful handling and disposal. Overall, 2,7-bis(bromomethyl)naphthalene serves as a valuable building block in synthetic organic chemistry, particularly in the development of functionalized naphthalene derivatives.
Formula:C12H10Br2
InChI:InChI=1/C12H10Br2/c13-7-9-1-3-11-4-2-10(8-14)6-12(11)5-9/h1-6H,7-8H2
SMILES:c1cc2ccc(cc2cc1CBr)CBr
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2,7-Bis(bromomethyl)naphthalene
CAS:2,7-Bis(bromomethyl)naphthalenePurity:98%Color and Shape:SolidMolecular weight:314.02g/mol2,7-Bis(bromomethyl)naphthalene
CAS:2,7-Bis(bromomethyl)naphthalene is a ligand that interacts with metal ions. It has been shown to cleave DNA and RNA in the presence of light and anions. 2,7-Bis(bromomethyl)naphthalene binds to the termini of DNA and RNA by hydrogen bonding or ionic interactions with the negatively charged phosphate groups. This interaction leads to the release of anions, which cause DNA repair enzymes to bind at the site of damage. This process can be used as a catalyst for chemical reactions where it is desirable to have one reactant remain intact while another reacts. 2,7-Bis(bromomethyl)naphthalene also fluoresces and can be used as a photophysical probe for studying DNA repair activities in cells or other biological systems.Formula:C12H10Br2Purity:Min. 95%Color and Shape:PowderMolecular weight:314.02 g/mol


