CAS 38309-89-6: 2,7-bis(bromomethyl)naphthalene

Description:2,7-bis(bromomethyl)naphthalene is an organic compound characterized by its naphthalene backbone, which features two bromomethyl groups attached at the 2 and 7 positions. This structure contributes to its reactivity and potential applications in organic synthesis, particularly in the formation of more complex molecules through cross-coupling reactions. The presence of bromine atoms enhances its electrophilic character, making it a useful intermediate in various chemical transformations. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its physical properties, such as melting point and boiling point, can vary based on purity and specific conditions. Additionally, due to the presence of bromine, it may pose certain hazards, including toxicity and environmental concerns, necessitating careful handling and disposal. Overall, 2,7-bis(bromomethyl)naphthalene serves as a valuable building block in synthetic organic chemistry, particularly in the development of functionalized naphthalene derivatives.

Formula:C₁₂H₁₀Br₂

InChI:InChI=1/C12H10Br2/c13-7-9-1-3-11-4-2-10(8-14)6-12(11)5-9/h1-6H,7-8H2

Found 3 products.

Product data	Purity	Price range	Estimated delivery
2,7-Bis(bromomethyl)naphthalene REF: 54-OR55701CAS: 38309-89-6	- - -	168.00 €~2,075.00 €	Mon 21 Apr 25
2,7-Bis(bromomethyl)naphthalene REF: 4Z-N-077060CAS: 38309-89-6	- - -	To inquire	Thu 24 Apr 25
2,7-Bis(bromomethyl)naphthalene REF: 3D-FB148930CAS: 38309-89-6	Min. 95%	143.00 €~484.00 €	Thu 12 Jun 25