CAS 3831-29-6
:1-fluoro-4-(iodomethyl)benzene
Description:
1-Fluoro-4-(iodomethyl)benzene, with the CAS number 3831-29-6, is an aromatic halogenated compound characterized by the presence of both fluorine and iodine substituents on a benzene ring. The structure consists of a fluorine atom attached to the para position and an iodomethyl group at the meta position relative to each other on the benzene ring. This compound is typically a colorless to pale yellow liquid or solid, depending on its state at room temperature. It is known for its reactivity due to the presence of halogen atoms, which can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The presence of the fluorine atom can influence the electronic properties of the molecule, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, its halogenated nature may impart unique physical properties, such as increased density and boiling point compared to non-halogenated benzene derivatives. Safety precautions should be taken when handling this compound due to its potential toxicity and reactivity.
Formula:C7H6FI
InChI:InChI=1/C7H6FI/c8-7-3-1-6(5-9)2-4-7/h1-4H,5H2
SMILES:c1cc(ccc1CI)F
Synonyms:- Benzene, 1-Fluoro-4-(Iodomethyl)-
- 1-Fluoro-4-(iodomethyl)benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.