CymitQuimica logo

CAS 383127-22-8

:

2-(4-Bromophenyl)pyrrolidine

Description:
2-(4-Bromophenyl)pyrrolidine is an organic compound characterized by its pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle. The presence of a bromophenyl group at the second position of the pyrrolidine ring significantly influences its chemical properties and reactivity. This compound typically exhibits a white to off-white solid appearance and is soluble in organic solvents such as ethanol and dichloromethane, but may have limited solubility in water due to its hydrophobic bromophenyl substituent. The bromine atom introduces both steric and electronic effects, which can affect the compound's reactivity in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, 2-(4-Bromophenyl)pyrrolidine may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in the synthesis of pharmaceuticals or as a building block in organic synthesis. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with brominated compounds.
Formula:C10H12BrN
InChI:InChI=1/C10H12BrN/c11-9-5-3-8(4-6-9)10-2-1-7-12-10/h3-6,10,12H,1-2,7H2
InChI key:HIJZBROSVFKSCP-UHFFFAOYSA-N
SMILES:C1CC(c2ccc(cc2)Br)NC1
Synonyms:
  • Pyrrolidine, 2-(4-bromophenyl)-
  • 2-(4-Bromo-Phenyl)-Pyrrolidine
Found 5 products.