CAS 383127-55-7

Pyrrolidine, 2-(3-phenylpropyl)-

Description:

Pyrrolidine, 2-(3-phenylpropyl)-, also known by its CAS number 383127-55-7, is a chemical compound characterized by a pyrrolidine ring substituted with a 3-phenylpropyl group. This structure imparts unique properties to the molecule, including its potential as a ligand in various chemical reactions and its relevance in medicinal chemistry. Pyrrolidine itself is a five-membered saturated nitrogen-containing heterocycle, which contributes to the compound's basicity and ability to participate in hydrogen bonding. The phenylpropyl substituent enhances the lipophilicity of the compound, potentially influencing its pharmacokinetic properties. This compound may exhibit biological activity, making it of interest in drug development and research. Its synthesis typically involves the reaction of appropriate precursors under controlled conditions, and it may be analyzed using techniques such as NMR spectroscopy or mass spectrometry to confirm its structure and purity. As with many organic compounds, safety precautions should be observed when handling this substance due to potential toxicity or reactivity.

Formula: C₁₃H₁₉N

InChI: InChI=1S/C13H19N/c1-2-6-12(7-3-1)8-4-9-13-10-5-11-14-13/h1-3,6-7,13-14H,4-5,8-11H2

InChI key: InChIKey=NDXMZQWEQVHWOO-UHFFFAOYSA-N

SMILES: C(CCC1=CC=CC=C1)C2CCCN2

Synonyms:

• Pyrrolidine, 2-(3-phenylpropyl)-
• 2-(3-Phenylpropyl)pyrrolidine

2-(3-Phenylpropyl)pyrrolidine

CAS: 383127-55-7

Versatile small molecule scaffold

Formula: C₁₃H₁₉N

Purity: Min. 95%

Molecular weight: 189.3 g/mol

Ref: 3D-IQA12755