CAS 383127-79-5

2-(3-bromophenyl)pyrrolidine

Description:

2-(3-Bromophenyl)pyrrolidine is an organic compound characterized by its pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle. The presence of a 3-bromophenyl group indicates that a bromine atom is attached to the phenyl ring at the meta position relative to the point of attachment to the pyrrolidine. This compound typically exhibits properties associated with both aromatic and aliphatic systems, including potential hydrophobic characteristics due to the brominated phenyl group. It may participate in various chemical reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions, owing to the reactivity of the bromine atom. The compound's structure suggests it could have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with pyrrolidine derivatives. Additionally, its physical properties, such as solubility and melting point, would depend on the specific interactions between the pyrrolidine and bromophenyl moieties, as well as the overall molecular conformation.

Formula: C₁₀H₁₂BrN

InChI: InChI=1/C10H12BrN/c11-9-4-1-3-8(7-9)10-5-2-6-12-10/h1,3-4,7,10,12H,2,5-6H2

SMILES: c1cc(cc(c1)Br)C1CCCN1

Synonyms:

• Pyrrolidine, 2-(3-Bromophenyl)-
• 2-(3-Bromo-Phenyl)-Pyrrolidine

2-(3-Bromo-phenyl)-pyrrolidine

CAS: 383127-79-5

Formula: C₁₀H₁₂BrN

Purity: 95%

Color and Shape: Liquid

Molecular weight: 226.1130

Ref: IN-DA00BYM9

2-(3-Bromophenyl)pyrrolidine

CAS: 383127-79-5

2-(3-Bromophenyl)pyrrolidine

Purity: 95%

Molecular weight: 226.11g/mol

Ref: 54-OR321426

2-(3-BROMOPHENYL)PYRROLIDINE

CAS: 383127-79-5

Formula: C₁₀H₁₂BrN

Purity: 95%

Color and Shape: Liquid

Molecular weight: 226.117

Ref: 10-F501611

2-(3-Bromophenyl)pyrrolidine

CAS: 383127-79-5

Versatile small molecule scaffold

Formula: C₁₀H₁₂BrN

Purity: Min. 95%

Molecular weight: 226.12 g/mol

Ref: 3D-IQA12779