CAS 383128-28-7

2-[1,1′-Biphenyl]-4-ylpiperidine

Description:

2-[1,1′-Biphenyl]-4-ylpiperidine, identified by its CAS number 383128-28-7, is a chemical compound characterized by its unique structure, which includes a piperidine ring substituted with a biphenyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential applications in medicinal chemistry and material science. The biphenyl moiety enhances the compound's lipophilicity, which can influence its biological activity and interaction with various receptors or enzymes. Additionally, the presence of the piperidine ring may impart basic properties, allowing for protonation under certain conditions. The compound's molecular structure suggests potential for use in drug development, particularly in the design of ligands for neurotransmitter receptors. Its stability and reactivity can be influenced by the substituents on the biphenyl and piperidine components, making it a subject of interest for further research in synthetic and medicinal chemistry. Overall, 2-[1,1′-Biphenyl]-4-ylpiperidine represents a versatile scaffold for exploring new chemical entities.

Formula: C₁₇H₁₉N

InChI: InChI=1S/C17H19N/c1-2-6-14(7-3-1)15-9-11-16(12-10-15)17-8-4-5-13-18-17/h1-3,6-7,9-12,17-18H,4-5,8,13H2

InChI key: InChIKey=WQIHYIUYBRGORU-UHFFFAOYSA-N

SMILES: C1(=CC=C(C=C1)C2CCCCN2)C3=CC=CC=C3

Synonyms:

• 2-[1,1′-Biphenyl]-4-ylpiperidine
• Piperidine, 2-[1,1′-biphenyl]-4-yl-

2-(4-Phenylphenyl)piperidine

CAS: 383128-28-7

Versatile small molecule scaffold

Formula: C₁₇H₁₉N

Purity: Min. 95%

Molecular weight: 237.34 g/mol

Ref: 3D-IQA12828