
CAS 383128-61-8
:2-(2,4-Dichlorophenyl)piperidine
Description:
2-(2,4-Dichlorophenyl)piperidine, with the CAS number 383128-61-8, is a chemical compound characterized by its piperidine core substituted with a dichlorophenyl group. This compound typically exhibits a white to off-white crystalline appearance and is known for its role in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the dichlorophenyl moiety contributes to its lipophilicity, which can influence its bioavailability and interaction with biological targets. It may exhibit various pharmacological activities, including potential effects on the central nervous system, making it of interest in the study of neuroactive compounds. Additionally, the compound's structure suggests it may engage in hydrogen bonding and other intermolecular interactions, which can affect its solubility and reactivity. Safety and handling precautions are essential, as with many organic compounds, due to potential toxicity and environmental impact. Overall, 2-(2,4-Dichlorophenyl)piperidine serves as a significant compound in research and development within the field of medicinal chemistry.
Formula:C11H13Cl2N
InChI:InChI=1S/C11H13Cl2N/c12-8-4-5-9(10(13)7-8)11-3-1-2-6-14-11/h4-5,7,11,14H,1-3,6H2
InChI key:InChIKey=YHDPNUBWYAFEEQ-UHFFFAOYSA-N
SMILES:ClC1=C(C2CCCCN2)C=CC(Cl)=C1
Synonyms:- 2-(2,4-Dichlorophenyl)piperidine
- Piperidine, 2-(2,4-dichlorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.