CAS 383129-07-5
:2-furan-2-ylazepane
Description:
2-Furan-2-ylazepane, with the CAS number 383129-07-5, is a chemical compound characterized by its unique structure that includes a furan ring and a seven-membered azepane ring. The furan moiety contributes to its aromatic properties, while the azepane ring introduces a cyclic amine component, which can influence its reactivity and interaction with biological systems. This compound may exhibit interesting pharmacological properties due to the presence of both the furan and azepane functionalities, potentially allowing for interactions with various biological targets. Its solubility, stability, and reactivity can be influenced by the presence of functional groups and the overall molecular conformation. As with many heterocyclic compounds, 2-furan-2-ylazepane may be of interest in medicinal chemistry and materials science, where its unique structural features could be leveraged for the development of new therapeutic agents or materials. However, specific data regarding its physical properties, such as melting point, boiling point, and spectral characteristics, would require further investigation or reference to specialized chemical databases.
Formula:C10H15NO
InChI:InChI=1/C10H15NO/c1-2-5-9(11-7-3-1)10-6-4-8-12-10/h4,6,8-9,11H,1-3,5,7H2
SMILES:C1CCC(c2ccco2)NCC1
Synonyms:- 1H-azepine, 2-(2-furanyl)hexahydro-
- 2-(2-Furyl)azepan
- 2-(2-Furyl)azepane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-Furan-2-yl-azepane
CAS:2-Furan-2-yl-azepane is an ether with the molecular formula CH3OCH2CH2OCH2. It is a colorless liquid that has a boiling point of 151 °C and melting point of -251 °C. 2-Furan-2-yl-azepane is soluble in methanol, ethanol, acetone, and chloroform. When it reacts with a carboxylic acid, it forms an ester. The molecule can exist in two different conformations: the five membered ring can be rotated or not rotated. 2-Furan-2-yl-azepane has been used as a model for the study of carbonic acid derivatives.
Formula:C10H15NO·HClPurity:Min. 95%Molecular weight:201.69 g/mol

