CymitQuimica logo

CAS 383130-06-1

:

2-(3-fluorophenyl)azepane

Description:
2-(3-Fluorophenyl)azepane is a chemical compound characterized by its azepane ring, which is a seven-membered saturated heterocyclic structure containing one nitrogen atom. The presence of a 3-fluorophenyl group indicates that a fluorine atom is substituted on the phenyl ring at the meta position relative to the azepane attachment. This substitution can influence the compound's electronic properties and reactivity. The molecular structure contributes to its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where modifications to the phenyl group can affect biological activity. The compound's properties, such as solubility, boiling point, and stability, are influenced by the azepane ring and the fluorine substituent, which can enhance lipophilicity and alter interaction with biological targets. As with many organic compounds, safety and handling considerations are essential, particularly regarding its potential toxicity and environmental impact. Overall, 2-(3-fluorophenyl)azepane represents a class of compounds that may exhibit interesting pharmacological properties due to its unique structural features.
Formula:C12H16FN
InChI:InChI=1/C12H16FN/c13-11-6-4-5-10(9-11)12-7-2-1-3-8-14-12/h4-6,9,12,14H,1-3,7-8H2
InChI key:FKCWIPFGJXWSCL-UHFFFAOYSA-N
SMILES:C1CCC(c2cccc(c2)F)NCC1
Synonyms:
  • 1H-Azepine, 2-(3-fluorophenyl)hexahydro-
Found 1 products.