CAS 383130-99-2

5-(3-Bromophenyl)-4H-1,2,4-triazol-3-amine

Description:

5-(3-Bromophenyl)-4H-1,2,4-triazol-3-amine is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. The presence of the 3-bromophenyl group indicates that a bromine atom is substituted on the phenyl ring at the meta position, contributing to the compound's unique reactivity and potential biological activity. This compound is typically used in pharmaceutical research and development due to its potential as a bioactive molecule. It may exhibit properties such as antimicrobial, antifungal, or anticancer activities, making it of interest in medicinal chemistry. The amine functional group enhances its solubility and reactivity, allowing for further derivatization. Additionally, the compound's molecular structure suggests it may participate in hydrogen bonding, influencing its interactions in biological systems. As with many triazole derivatives, it may also serve as a scaffold for the design of new therapeutic agents. Safety and handling precautions should be observed due to the presence of bromine and the potential for biological activity.

Formula: C₈H₇BrN₄

InChI: InChI=1/C8H7BrN4/c9-6-3-1-2-5(4-6)7-11-8(10)13-12-7/h1-4H,(H3,10,11,12,13)

SMILES: c1cc(cc(c1)Br)c1nc(=N)[nH][nH]1

Synonyms:

• 4H-1,2,4-triazol-3-amine, 5-(3-bromophenyl)-
• 5-(3-bromophenyl)-1H-1,2,4-triazol-3-amine

5-(3-Bromophenyl)-4H-1,2,4-triazol-3-amine

CAS: 383130-99-2

Versatile small molecule scaffold

Formula: C₈H₇BrN₄

Purity: Min. 95%

Molecular weight: 239.07 g/mol

Ref: 3D-IQA13099