CAS 383131-41-7
:4-chloro-6-methyl-1,3-benzothiazol-2-amine
Description:
4-Chloro-6-methyl-1,3-benzothiazol-2-amine is an organic compound characterized by its benzothiazole structure, which consists of a fused benzene and thiazole ring. The presence of a chlorine atom at the 4-position and a methyl group at the 6-position of the benzothiazole ring contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic aromatic structure. It is often used in various applications, including pharmaceuticals and agrochemicals, due to its potential biological activity. The amine functional group can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be utilized for its identification and characterization. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C8H7ClN2S
InChI:InChI=1/C8H7ClN2S/c1-4-2-5(9)7-6(3-4)12-8(10)11-7/h2-3H,1H3,(H2,10,11)
SMILES:Cc1cc(c2c(c1)sc(=N)[nH]2)Cl
Synonyms:- 2-Benzothiazolamine, 4-Chloro-6-Methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
