CAS 383131-52-0

6-Bromo-4-ethyl-2-benzothiazolamine

Description:

6-Bromo-4-ethyl-2-benzothiazolamine is an organic compound characterized by its benzothiazole core, which features a bromine atom and an ethyl group as substituents. The presence of the bromine atom typically enhances the compound's reactivity, making it useful in various chemical reactions, including nucleophilic substitutions. The benzothiazole structure contributes to its potential applications in pharmaceuticals, agrochemicals, and materials science due to its ability to participate in π-π stacking interactions and its fluorescent properties. The amine functional group in the compound can engage in hydrogen bonding, influencing its solubility and interaction with biological targets. Additionally, the ethyl group can affect the compound's lipophilicity, impacting its bioavailability and pharmacokinetics. Overall, 6-Bromo-4-ethyl-2-benzothiazolamine exhibits a combination of properties that make it a subject of interest in synthetic chemistry and medicinal research, although specific applications would depend on further studies and evaluations of its biological activity and safety profile.

Formula: C₉H₉BrN₂S

InChI: InChI=1S/C9H9BrN2S/c1-2-5-3-6(10)4-7-8(5)12-9(11)13-7/h3-4H,2H2,1H3,(H2,11,12)

InChI key: InChIKey=RLRFPJSDSWJTIX-UHFFFAOYSA-N

SMILES: C(C)C1=C2C(=CC(Br)=C1)SC(N)=N2

Synonyms:

• 6-Bromo-4-ethyl-2-benzothiazolamine
• 2-Benzothiazolamine, 6-bromo-4-ethyl-

6-Bromo-4-ethyl-1,3-benzothiazol-2-amine

CAS: 383131-52-0

Versatile small molecule scaffold

Formula: C₉H₉BrN₂S

Purity: Min. 95%

Molecular weight: 257.15 g/mol

Ref: 3D-IQA13152