CAS 383132-29-4

6-Chloro-7-methyl-1H-indole-2-carboxylic acid

Description:

6-Chloro-7-methyl-1H-indole-2-carboxylic acid is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a chlorine atom at the 6-position and a methyl group at the 7-position contributes to its unique reactivity and properties. This compound features a carboxylic acid functional group at the 2-position, which enhances its acidity and solubility in polar solvents. It is typically a solid at room temperature and may exhibit moderate stability under standard conditions. The compound is of interest in various fields, including medicinal chemistry, due to its potential biological activity and applications in drug development. Its specific interactions and reactivity can be influenced by the substituents on the indole ring, making it a subject of study for its pharmacological properties. As with many chemical substances, safety precautions should be observed when handling it, and its environmental impact should be considered in research and application contexts.

Formula: C₁₀H₈ClNO₂

InChI: InChI=1S/C10H8ClNO2/c1-5-7(11)3-2-6-4-8(10(13)14)12-9(5)6/h2-4,12H,1H3,(H,13,14)

InChI key: InChIKey=JJHFWFJPRJVRAW-UHFFFAOYSA-N

SMILES: CC1=C2C(C=C(C(O)=O)N2)=CC=C1Cl

Synonyms:

• 1H-Indole-2-carboxylic acid, 6-chloro-7-methyl-
• 6-Chloro-7-methyl-1H-indole-2-carboxylic acid

6-Chloro-7-methyl-1H-indole-2-carboxylic Acid

Controlled Product

CAS: 383132-29-4

Formula: C₁₀H₈ClNO₂

Color and Shape: Neat

Molecular weight: 209.629

Ref: TR-C385613