CAS 383136-02-5: 1-[2-(1-Methylethyl)phenyl]-1H-pyrrole-2-carboxaldehyde

Description:1-[2-(1-Methylethyl)phenyl]-1H-pyrrole-2-carboxaldehyde, with the CAS number 383136-02-5, is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features a carboxaldehyde functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the isopropyl-substituted phenyl group enhances its hydrophobic characteristics, influencing its solubility and interaction with biological systems. Typically, compounds like this may exhibit interesting biological activities, making them of interest in medicinal chemistry and drug development. The molecular structure suggests potential for various chemical reactions, including nucleophilic additions and condensation reactions, due to the electrophilic nature of the aldehyde group. Additionally, the compound's stability and reactivity can be influenced by factors such as temperature and solvent conditions. Overall, this compound represents a unique structure that may serve as a building block in the synthesis of more complex molecules or as a lead compound in pharmacological research.

Formula:C₁₄H₁₅NO

InChI:InChI=1S/C14H15NO/c1-11(2)13-7-3-4-8-14(13)15-9-5-6-12(15)10-16/h3-11H,1-2H3

InChI key:InChIKey=BPZQZGBFTFSLMX-UHFFFAOYSA-N

SMILES:O=CC1=CC=CN1C=2C=CC=CC2C(C)C