CymitQuimica logo

CAS 383147-59-9

:

N-[[1-(2-Thiazolyl)-1H-pyrrol-2-yl]methylene]-3-(trifluoromethyl)benzenemethanamine

Description:
N-[[1-(2-Thiazolyl)-1H-pyrrol-2-yl]methylene]-3-(trifluoromethyl)benzenemethanamine is a chemical compound characterized by its complex structure, which includes a thiazole ring, a pyrrole moiety, and a trifluoromethyl group. This compound typically exhibits properties such as moderate to high lipophilicity due to the presence of the trifluoromethyl group, which can enhance its biological activity and membrane permeability. The thiazole and pyrrole rings contribute to its potential as a pharmacophore, making it of interest in medicinal chemistry for the development of therapeutic agents. The compound may also display specific reactivity patterns due to the presence of the methylene bridge and the amine functional group, which can participate in various chemical reactions. Additionally, its unique structural features may influence its solubility, stability, and interaction with biological targets, making it a candidate for further research in drug discovery and development. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C16H12F3N3S
InChI:InChI=1S/C16H12F3N3S/c17-16(18,19)13-4-1-3-12(9-13)10-20-11-14-5-2-7-22(14)15-21-6-8-23-15/h1-9,11H,10H2
InChI key:InChIKey=RGGOVGSRCCILMK-UHFFFAOYSA-N
SMILES:C(=NCC1=CC(C(F)(F)F)=CC=C1)C=2N(C=CC2)C3=NC=CS3
Synonyms:
  • Benzenemethanamine, N-[[1-(2-thiazolyl)-1H-pyrrol-2-yl]methylene]-3-(trifluoromethyl)-
  • N-[[1-(2-Thiazolyl)-1H-pyrrol-2-yl]methylene]-3-(trifluoromethyl)benzenemethanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.