CAS 383148-46-7
:N-Methyl-3-phenyl-6-(trifluoromethyl)-1,2,4-triazin-5-amine
Description:
N-Methyl-3-phenyl-6-(trifluoromethyl)-1,2,4-triazin-5-amine is a chemical compound characterized by its unique triazine structure, which includes a trifluoromethyl group and a phenyl substituent. This compound typically exhibits properties associated with triazines, such as potential applications in agrochemicals and pharmaceuticals due to its biological activity. The presence of the trifluoromethyl group enhances lipophilicity and can influence the compound's reactivity and stability. The amine functional group contributes to its potential as a nucleophile in various chemical reactions. Additionally, the methyl group attached to the nitrogen atom can affect the compound's solubility and interaction with biological targets. Overall, this compound's structural features suggest it may possess interesting pharmacological properties, making it a subject of interest in medicinal chemistry and related fields. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C11H9F3N4
InChI:InChI=1S/C11H9F3N4/c1-15-10-8(11(12,13)14)17-18-9(16-10)7-5-3-2-4-6-7/h2-6H,1H3,(H,15,16,18)
InChI key:InChIKey=VWCUKIMQFRFYEF-UHFFFAOYSA-N
SMILES:N(C)C1=NC(=NN=C1C(F)(F)F)C2=CC=CC=C2
Synonyms:- 1,2,4-Triazin-5-amine, N-methyl-3-phenyl-6-(trifluoromethyl)-
- N-Methyl-3-phenyl-6-(trifluoromethyl)-1,2,4-triazin-5-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-Methyl-3-phenyl-6-(trifluoromethyl)-1,2,4-triazin-5-amine
CAS:N-Methyl-3-phenyl-6-(trifluoromethyl)-1,2,4-triazin-5-aminePurity:techMolecular weight:254.21g/mol
