CymitQuimica logo

CAS 38324-83-3

:

2-oxo-1,2-dihydropyrimidine-5-carboxylic acid

Description:
2-Oxo-1,2-dihydropyrimidine-5-carboxylic acid, also known as a pyrimidine derivative, is characterized by its bicyclic structure that includes a pyrimidine ring with a keto group and a carboxylic acid functional group. This compound typically exhibits properties such as being a solid at room temperature, with moderate solubility in polar solvents due to the presence of the carboxylic acid group. It may participate in various chemical reactions, including condensation and substitution reactions, owing to its functional groups. The compound is of interest in medicinal chemistry, particularly for its potential biological activities, which may include antimicrobial or antitumor properties. Its structure allows for the possibility of forming hydrogen bonds, influencing its reactivity and interactions with other molecules. Additionally, the presence of the keto and carboxylic acid groups can affect its acidity and overall stability. As with many organic compounds, the specific characteristics can vary based on environmental conditions such as pH and temperature.
Formula:C5H4N2O3
InChI:InChI=1/C5H4N2O3/c8-4(9)3-1-6-5(10)7-2-3/h1-2H,(H,8,9)(H,6,7,10)
InChI key:CRCVTNHORFBTSX-UHFFFAOYSA-N
SMILES:c1c(cnc(n1)O)C(=O)O
Synonyms:
  • 2-Hydroxypyrimidine-5-carboxylic acid
  • 5-Pyrimidinecarboxylic acid, 2-hydroxy-
Found 4 products.