CAS 38336-10-6

1-[(2R)-tetrahydrofuran-2-ylmethyl]urea

Description:

1-[(2R)-tetrahydrofuran-2-ylmethyl]urea, with the CAS number 38336-10-6, is a chemical compound characterized by its urea functional group and a tetrahydrofuran moiety. This compound features a five-membered cyclic ether, which contributes to its unique structural properties. The presence of the tetrahydrofuran ring enhances its solubility in polar solvents, making it useful in various chemical applications. The (2R) configuration indicates that the compound has chirality, which can influence its biological activity and interactions with other molecules. Typically, urea derivatives are known for their ability to form hydrogen bonds, which can affect their reactivity and stability. This compound may be of interest in medicinal chemistry and materials science due to its potential applications in drug development or as a building block in organic synthesis. Its specific characteristics, such as melting point, boiling point, and reactivity, would depend on the molecular environment and conditions under which it is studied.

Formula: C₆H₁₂N₂O₂

InChI: InChI=1/C6H12N2O2/c7-6(9)8-4-5-2-1-3-10-5/h5H,1-4H2,(H3,7,8,9)

SMILES: C1CC(CNC(=N)O)OC1

Synonyms:

• (Tetrahydro-furan-2-ylmethyl)-urea
• 1-(Tetrahydrofuran-2-Ylmethyl)Urea

[(Oxolan-2-yl)methyl]urea

CAS: 38336-10-6

Versatile small molecule scaffold

Formula: C₆H₁₂N₂O₂

Purity: Min. 95%

Molecular weight: 144.17 g/mol

Ref: 3D-NBA33610