CAS 383371-02-6

6-amino-2-(trifluoromethyl)-4H-chromen-4-one

Description:

6-Amino-2-(trifluoromethyl)-4H-chromen-4-one is a chemical compound characterized by its chromenone structure, which features a fused benzene and pyrone ring. The presence of an amino group at the 6-position and a trifluoromethyl group at the 2-position significantly influences its chemical properties and reactivity. This compound typically exhibits a yellow to orange color and is soluble in organic solvents, making it useful in various applications, including pharmaceuticals and agrochemicals. The trifluoromethyl group enhances lipophilicity and can improve biological activity, while the amino group may participate in hydrogen bonding and nucleophilic reactions. Additionally, this compound may exhibit fluorescence properties, which can be advantageous in analytical applications. Its unique structural features and functional groups contribute to its potential as a building block in organic synthesis and medicinal chemistry. As with many fluorinated compounds, it is essential to handle it with care due to potential environmental and health impacts.

Formula: C₁₀H₆F₃NO₂

InChI: InChI=1/C10H6F3NO2/c11-10(12,13)9-4-7(15)6-3-5(14)1-2-8(6)16-9/h1-4H,14H2

SMILES: c1cc2c(cc1N)c(=O)cc(C(F)(F)F)o2

Synonyms:

• 4H-1-Benzopyran-4-one, 6-amino-2-(trifluoromethyl)-
• 6-Amino-2-trifluoromethyl-chromen-4-one
• 6-Amino-2-(trifluoromethyl)-4H-chromen-4-one

6-Amino-2-(trifluoromethyl)-4H-chromen-4-one

CAS: 383371-02-6

6-Amino-2-(trifluoromethyl)-4H-chromen-4-one

Purity: ≥95%

Molecular weight: 229.16g/mol

Ref: 54-PC410199