CAS 38339-23-0

1-(4-amino-3,5-dichlorophenyl)-2-[(2-methylpentan-2-yl)amino]ethanol

Description:

1-(4-amino-3,5-dichlorophenyl)-2-[(2-methylpentan-2-yl)amino]ethanol, with the CAS number 38339-23-0, is a chemical compound characterized by its complex structure, which includes an amino group, a dichlorophenyl moiety, and an ethanolamine component. This compound typically exhibits properties associated with both amines and alcohols, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding. The presence of the dichlorophenyl group may impart specific electronic and steric effects, influencing its reactivity and biological activity. Compounds of this nature are often studied for their pharmacological properties, as they may interact with biological targets due to their functional groups. Additionally, the branched alkyl chain (2-methylpentan-2-yl) can affect the lipophilicity and overall pharmacokinetics of the molecule. As with many organic compounds, safety and handling precautions are essential, given the potential toxicity associated with certain functional groups, particularly those containing halogens and amines.

Formula: C₁₄H₂₂Cl₂N₂O

InChI: InChI=1/C14H22Cl2N2O/c1-4-5-14(2,3)18-8-12(19)9-6-10(15)13(17)11(16)7-9/h6-7,12,18-19H,4-5,8,17H2,1-3H3

SMILES: CCCC(C)(C)NCC(c1cc(c(c(c1)Cl)N)Cl)O

Clenhexerol

Controlled Product

CAS: 38339-23-0

Applications A classical β-adrenergic agonist in retina in interlaboratory study.
References Horwitz, W., et al.: Anal. Chem., 54, 67 (1982), Gowik, P., et al.: Analyst, 125, 1103 (2000),

Formula: C₁₄H₂₂Cl₂N₂O

Color and Shape: Neat

Molecular weight: 305.24

Ref: TR-C572600

Clenhexerol

CAS: 38339-23-0

Clenhexerol is a medicinal analog that has been shown to have potent anti-cancer properties. It works as a protein kinase inhibitor, which means it prevents the activity of enzymes involved in cell growth and division. Clenhexerol induces apoptosis (programmed cell death) in cancer cells, helping to slow tumor growth and spread. Studies have shown that it can inhibit the cell cycle and reduce the activity of Chinese hamster ovary kinases. Clenhexerol has also been detected in human urine, indicating its potential for use as a therapeutic agent against cancer.

Formula: C₁₄H₂₂Cl₂N₂O

Purity: Min. 95%

Molecular weight: 305.2 g/mol

Ref: 3D-NBA33923