CAS 383417-48-9
:N-Nitroso-N-pentyl-2-pyridinemethanamine
Description:
N-Nitroso-N-pentyl-2-pyridinemethanamine is a chemical compound characterized by its nitroso group, which is a functional group containing nitrogen and oxygen. This compound features a pentyl chain attached to a pyridine ring, which contributes to its structural complexity and potential biological activity. The presence of the nitroso group suggests that it may have properties related to nitrosamines, which are known for their potential carcinogenic effects. The compound's molecular structure indicates that it may participate in various chemical reactions, particularly those involving nucleophilic attack due to the presence of the nitrogen atom in the pyridine ring. Additionally, the compound's solubility and stability can be influenced by the length of the pentyl chain and the overall polarity of the molecule. As with many nitroso compounds, safety precautions should be taken when handling N-Nitroso-N-pentyl-2-pyridinemethanamine due to its potential health risks. Further studies would be necessary to fully understand its reactivity, toxicity, and applications in various fields, including medicinal chemistry and materials science.
Formula:C11H17N3O
InChI:InChI=1S/C11H17N3O/c1-2-3-6-9-14(13-15)10-11-7-4-5-8-12-11/h4-5,7-8H,2-3,6,9-10H2,1H3
InChI key:InChIKey=SSGNCWJROPKVJX-UHFFFAOYSA-N
SMILES:C(N(CCCCC)N=O)C1=CC=CC=N1
Synonyms:- N-Nitroso-N-pentyl-2-pyridinemethanamine
- 2-Pyridinemethanamine, N-nitroso-N-pentyl-
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N’-Nitrosopentyl-(2-picolyl)amine
CAS:Controlled ProductApplications N’-Nitrosopentylpicolyamine can be used as an internal standard for the determination of tobacco-specific nitrosamines using gas chromatography in combination with chemiluminescence detection.
References Speigelhalder, B., et al.: Beitrage zur Tabakforschung Int’l., 14, 3, 135 (1989)Formula:C11H17N3OColor and Shape:NeatMolecular weight:207.27
