CymitQuimica logo

CAS 383427-88-1

:

4-amino-2-methyl-5-propyl-pyrazole-3-carboxylic acid

Description:
4-Amino-2-methyl-5-propyl-pyrazole-3-carboxylic acid is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features an amino group (-NH2), a carboxylic acid group (-COOH), and alkyl substituents, specifically a methyl group and a propyl group, which contribute to its unique properties. The presence of the amino and carboxylic acid functional groups suggests that it can participate in various chemical reactions, including acid-base reactions and potential interactions with biological systems. The compound's structure may confer specific biological activities, making it of interest in pharmaceutical research. Additionally, its solubility and stability can be influenced by the substituents on the pyrazole ring. Overall, 4-amino-2-methyl-5-propyl-pyrazole-3-carboxylic acid is a versatile compound with potential applications in medicinal chemistry and related fields.
Formula:C8H13N3O2
InChI:InChI=1/C8H13N3O2/c1-3-4-5-6(9)7(8(12)13)11(2)10-5/h3-4,9H2,1-2H3,(H,12,13)
SMILES:CCCc1c(c(C(=O)O)n(C)n1)N
Synonyms:
  • 1H-pyrazole-5-carboxylic acid, 4-amino-1-methyl-3-propyl-
  • 4-amino-1-methyl-3-propyl-1H-pyrazole-5-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.