CAS 3835-21-0

6-methoxy-2,3-dihydroquinolin-4(1H)-one

Description:

6-Methoxy-2,3-dihydroquinolin-4(1H)-one, with the CAS number 3835-21-0, is a chemical compound that belongs to the class of quinolines, which are bicyclic aromatic compounds. This substance features a methoxy group (-OCH3) at the 6-position and a carbonyl group (C=O) at the 4-position of the quinoline structure. It is characterized by its potential biological activity, which may include antimicrobial, anti-inflammatory, or anticancer properties, making it of interest in pharmaceutical research. The compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water, which is common for many quinoline derivatives. Its molecular structure contributes to its reactivity and interaction with biological targets. Additionally, the presence of the methoxy group can influence its electronic properties and overall stability. As with many organic compounds, handling should be done with care, considering safety protocols to avoid exposure.

Formula: C₁₀H₁₁NO₂

InChI: InChI=1/C10H11NO2/c1-13-7-2-3-9-8(6-7)10(12)4-5-11-9/h2-3,6,11H,4-5H2,1H3

SMILES: COc1ccc2c(c1)C(=O)CCN2

6-Methoxy-2,3-dihydroquinolin-4(1H)-one

CAS: 3835-21-0

Formula: C₁₀H₁₁NO₂

Molecular weight: 177.1998

Ref: IN-DA00CKZ7

6-Methoxy-2,3-dihydroquinolin-4(1H)-one

CAS: 3835-21-0

6-Methoxy-2,3-dihydroquinolin-4(1H)-one is a target compound that can be synthesized in an intramolecular condensation process. In this reaction, two molecules of acetone react with each other to form a cyclic six-membered ring. The hydrolysis of the ester bond then releases the desired product. This process is catalyzed by glutathione reductase and requires NADPH as a cofactor.

Formula: C₁₀H₁₁NO₂

Purity: Min. 95%

Molecular weight: 177.2 g/mol

Ref: 3D-DAA83521